Jump to content

Documentation:CHBE Exam Wiki/CHEM 154 Review

From UBC Wiki

Reaction Stoichiometry

Reaction stoichiometry allows us to determine the amount of substance that is consumed or produced by a reaction. Think of a molecule's molecular equation, such as:

SO2(g)

as the ratio of stuff in the molecule. In this case, it would be 1 sulfur atom to 2 oxygen atoms in this sulfur dioxide molecule.

Now stoichiometry is the theory of this proportion applied to chemical equations. Think of it as a mathematical equation where everything on the left has to equal everything on the left (2=1+1).

Coefficients in chemistry act the same as coefficients in math, multiplying everything in the molecular equation by the coefficient to represent the total number of atoms at play.

Building on the sulfur dioxide example, the production of sulfur dioxide is essential in the production of fertilizers, metal processing, and cocaine.

Many metal ores occur as sulfides and are roasted to form an oxide and sulfur dioxide, for example, in the manufacture of lead:

2PbS(s)+3O2(g)2PbOs+2SO2(g)

This equation indicates that for every 2 molecules (g-moles, lb-moles) of PbS that react/3 molecules (g-mole, lb-mole) of O2 reacts to produce 2 molecules (g-moles, lb-moles) of PbO and 2 molecules of SO2.

The numbers that precede the formulas for each species are the stoichiometric coefficients of the reaction components. Overall, it is akin to making the equation say

2Pbatoms+2Satoms+6Oatoms=2Pbatoms+2Oatoms+2Satoms+4Oatoms

(if we "multiply out" the molecular equations)

Note that the total number of atoms on the left equal the number on the right. Knowing the total number of atoms in the reactant and product side of the equation allows us to then use their respective molar masses to find the total mass of the reactants or products.

Steps in balancing reaction stoichiometry

Let's use the previous example of 2PbS(s)+3O2(g) to explore balancing a reaction. We usually don't get pre-balanced equations, so when we are asked what is the equation of the reaction of lead sulfide and oxygen, we start off with PbS and O2.

1. In the first step, write out the reaction. PbS(s)+O2(g)PbO(s)+SO2(g)

2. Give each molecule an unknown coefficient.

(a)PbS(s)+(b)O2(g)(c)PbO(s)+(d)SO2(g)

3. Balance the coefficients based on the atoms found in the chemical equation

(a)PbS(s)+(b)O2(g)(c)PbO(s)+(d)SO2(g) Pb:a=c S:a=d O:2b=c+2d

Notice that in this case, we cannot solve for all the unknowns, since we only have 3 equations but 4 unknowns (You will use this method to determine if material or energy balances can be solved later in the course).

In this case, we solve for equality between 2 coefficients

2b=a+2a 2b=3a b=3/2a

We then choose a "basis", a random number for 'a' that will then give us all the subsequent coefficients of 'b', 'c' and 'd'.

a=1 b=3/2 c=1 d=1

PbS(s)+3/2O2(g)PbO(s)+SO2(g)

Which is equivalent to

2PbS(s)+3O2(g)2PbOs+2SO2(g)